C8H11N — CID 140784055
5,6-dimethyl-2-methylidene-3H-pyridine (PubChem CID 140784055) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 5,6-dimethyl-2-methylidene-3H-pyridine.
| Compound Name | 5,6-dimethyl-2-methylidene-3H-pyridine |
|---|---|
| PubChem CID | 140784055 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 5,6-dimethyl-2-methylidene-3H-pyridine |
| SMILES | C=C1CC=C(C)C(C)=N1 |
| InChI | InChI=1S/C8H11N/c1-6-4-5-7(2)9-8(6)3/h4H,2,5H2,1,3H3 |
| InChIKey | GBXVXAHBUHSOLG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |