C12H29NOSi2 — CID 140784793
2-triethylsilyl-1-trimethylsilyliminopropan-2-ol (PubChem CID 140784793) has the molecular formula C12H29NOSi2 and a molecular weight of 259.54 g/mol. Its IUPAC name is 2-triethylsilyl-1-trimethylsilyliminopropan-2-ol.
| Compound Name | 2-triethylsilyl-1-trimethylsilyliminopropan-2-ol |
|---|---|
| PubChem CID | 140784793 |
| Molecular Formula | C12H29NOSi2 |
| Molecular Weight | 259.54 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-triethylsilyl-1-trimethylsilyliminopropan-2-ol |
| SMILES | CC[Si](CC)(CC)C(C)(O)C=N[Si](C)(C)C |
| InChI | InChI=1S/C12H29NOSi2/c1-8-16(9-2,10-3)12(4,14)11-13-15(5,6)7/h11,14H,8-10H2,1-7H3 |
| InChIKey | ZFTDAJVFDLKFKG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|