C14H32N2OSi — CID 140782956
2-hydroxy-N,N-dimethyl-N'-propan-2-yl-2-triethylsilylpropanimidamide (PubChem CID 140782956) has the molecular formula C14H32N2OSi and a molecular weight of 272.51 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-N'-propan-2-yl-2-triethylsilylpropanimidamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-N'-propan-2-yl-2-triethylsilylpropanimidamide |
|---|---|
| PubChem CID | 140782956 |
| Molecular Formula | C14H32N2OSi |
| Molecular Weight | 272.51 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-N'-propan-2-yl-2-triethylsilylpropanimidamide |
| SMILES | CC[Si](CC)(CC)C(C)(O)/C(=N/C(C)C)N(C)C |
| InChI | InChI=1S/C14H32N2OSi/c1-9-18(10-2,11-3)14(6,17)13(16(7)8)15-12(4)5/h12,17H,9-11H2,1-8H3/b15-13- |
| InChIKey | NDCMQOFMGOBHAL-SQFISAMPSA-N |
| XLogP | 3.15 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|