[4-(2,3-difluorophenoxy)phenyl]boronic acid

C12H9BF2O3 — CID 140785253

IUPAC[4-(2,3-difluorophenoxy)phenyl]boronic acid
SMILESOB(O)c1ccc(Oc2cccc(F)c2F)cc1
InChIInChI=1S/C12H9BF2O3/c14-10-2-1-3-11(12(10)15)18-9-6-4-8(5-7-9)13(16)17/h1-7,16-17H
InChIKeyBPMRZJNRSNJGSS-UHFFFAOYSA-N
MW250.01 g/mol
LogP1.44
Rot. Bonds3

About [4-(2,3-difluorophenoxy)phenyl]boronic acid

[4-(2,3-difluorophenoxy)phenyl]boronic acid (PubChem CID 140785253) has the molecular formula C12H9BF2O3 and a molecular weight of 250.01 g/mol. Its IUPAC name is [4-(2,3-difluorophenoxy)phenyl]boronic acid.

Molecular Properties

Compound Name[4-(2,3-difluorophenoxy)phenyl]boronic acid
PubChem CID140785253
Molecular FormulaC12H9BF2O3
Molecular Weight250.01 g/mol
Exact Mass250.06
IUPAC Name[4-(2,3-difluorophenoxy)phenyl]boronic acid
SMILESOB(O)c1ccc(Oc2cccc(F)c2F)cc1
InChIInChI=1S/C12H9BF2O3/c14-10-2-1-3-11(12(10)15)18-9-6-4-8(5-7-9)13(16)17/h1-7,16-17H
InChIKeyBPMRZJNRSNJGSS-UHFFFAOYSA-N
XLogP1.44
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.01
LogP ≤ 51.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(2,3-difluorophenoxy)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(2,3-difluorophenoxy)phenyl]boronic acid?
The IUPAC name of [4-(2,3-difluorophenoxy)phenyl]boronic acid (CID 140785253) is [4-(2,3-difluorophenoxy)phenyl]boronic acid.
What is the SMILES notation for [4-(2,3-difluorophenoxy)phenyl]boronic acid?
The canonical SMILES for [4-(2,3-difluorophenoxy)phenyl]boronic acid is OB(O)c1ccc(Oc2cccc(F)c2F)cc1.
What is the InChIKey of [4-(2,3-difluorophenoxy)phenyl]boronic acid?
The InChIKey is BPMRZJNRSNJGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BF2O3/c14-10-2-1-3-11(12(10)15)18-9-6-4-8(5-7-9)13(16)17/h1-7,16-17H.
What are the key properties of [4-(2,3-difluorophenoxy)phenyl]boronic acid?
[4-(2,3-difluorophenoxy)phenyl]boronic acid has a molecular weight of 250.01 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-difluorophenoxy)phenyl]boronic acid is sourced from PubChem (CID 140785253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).