About 3-(2,3-difluorophenoxy)furan
3-(2,3-difluorophenoxy)furan (PubChem CID 76539749) has the molecular formula C10H6F2O2
and a molecular weight of 196.15 g/mol. Its IUPAC name is 3-(2,3-difluorophenoxy)furan.
Molecular Properties
| Compound Name | 3-(2,3-difluorophenoxy)furan |
| PubChem CID | 76539749 |
| Molecular Formula | C10H6F2O2 |
| Molecular Weight | 196.15 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 3-(2,3-difluorophenoxy)furan |
| SMILES | Fc1cccc(Oc2ccoc2)c1F |
| InChI | InChI=1S/C10H6F2O2/c11-8-2-1-3-9(10(8)12)14-7-4-5-13-6-7/h1-6H |
| InChIKey | IFKGCSUPSCCYCI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,3-difluorophenoxy)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-difluorophenoxy)furan?
The IUPAC name of 3-(2,3-difluorophenoxy)furan (CID 76539749) is 3-(2,3-difluorophenoxy)furan.
What is the SMILES notation for 3-(2,3-difluorophenoxy)furan?
The canonical SMILES for 3-(2,3-difluorophenoxy)furan is Fc1cccc(Oc2ccoc2)c1F.
What is the InChIKey of 3-(2,3-difluorophenoxy)furan?
The InChIKey is IFKGCSUPSCCYCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F2O2/c11-8-2-1-3-9(10(8)12)14-7-4-5-13-6-7/h1-6H.
What are the key properties of 3-(2,3-difluorophenoxy)furan?
3-(2,3-difluorophenoxy)furan has a molecular weight of 196.15 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-difluorophenoxy)furan is sourced from PubChem (CID 76539749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).