C12H9BrF2N2O — CID 118138308
[2-bromo-4-(2,3-difluorophenoxy)phenyl]hydrazine (PubChem CID 118138308) has the molecular formula C12H9BrF2N2O and a molecular weight of 315.12 g/mol. Its IUPAC name is [2-bromo-4-(2,3-difluorophenoxy)phenyl]hydrazine.
| Compound Name | [2-bromo-4-(2,3-difluorophenoxy)phenyl]hydrazine |
|---|---|
| PubChem CID | 118138308 |
| Molecular Formula | C12H9BrF2N2O |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | [2-bromo-4-(2,3-difluorophenoxy)phenyl]hydrazine |
| SMILES | NNc1ccc(Oc2cccc(F)c2F)cc1Br |
| InChI | InChI=1S/C12H9BrF2N2O/c13-8-6-7(4-5-10(8)17-16)18-11-3-1-2-9(14)12(11)15/h1-6,17H,16H2 |
| InChIKey | LAGGPAIXAKZQSX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|