C13H13ClF2N2O2 — CID 118138355
[4-(2,3-difluorophenoxy)-2-methoxyphenyl]hydrazine;hydrochloride (PubChem CID 118138355) has the molecular formula C13H13ClF2N2O2 and a molecular weight of 302.71 g/mol. Its IUPAC name is [4-(2,3-difluorophenoxy)-2-methoxyphenyl]hydrazine;hydrochloride.
| Compound Name | [4-(2,3-difluorophenoxy)-2-methoxyphenyl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 118138355 |
| Molecular Formula | C13H13ClF2N2O2 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | [4-(2,3-difluorophenoxy)-2-methoxyphenyl]hydrazine;hydrochloride |
| SMILES | COc1cc(Oc2cccc(F)c2F)ccc1NN.Cl |
| InChI | InChI=1S/C13H12F2N2O2.ClH/c1-18-12-7-8(5-6-10(12)17-16)19-11-4-2-3-9(14)13(11)15;/h2-7,17H,16H2,1H3;1H |
| InChIKey | RZXFONGNNBHYAL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|