C12H13FN4O — CID 80904650
N-(4-fluoro-2-methoxyphenyl)-6-hydrazinylpyridin-2-amine (PubChem CID 80904650) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxyphenyl)-6-hydrazinylpyridin-2-amine.
| Compound Name | N-(4-fluoro-2-methoxyphenyl)-6-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 80904650 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N-(4-fluoro-2-methoxyphenyl)-6-hydrazinylpyridin-2-amine |
| SMILES | COc1cc(F)ccc1Nc1cccc(NN)n1 |
| InChI | InChI=1S/C12H13FN4O/c1-18-10-7-8(13)5-6-9(10)15-11-3-2-4-12(16-11)17-14/h2-7H,14H2,1H3,(H2,15,16,17) |
| InChIKey | FNAYWDCAKPQAMD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|