C12H10FN3O3 — CID 66449876
6-(4-fluoro-2-methoxyanilino)pyrazine-2-carboxylic acid (PubChem CID 66449876) has the molecular formula C12H10FN3O3 and a molecular weight of 263.23 g/mol. Its IUPAC name is 6-(4-fluoro-2-methoxyanilino)pyrazine-2-carboxylic acid.
| Compound Name | 6-(4-fluoro-2-methoxyanilino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 66449876 |
| Molecular Formula | C12H10FN3O3 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 6-(4-fluoro-2-methoxyanilino)pyrazine-2-carboxylic acid |
| SMILES | COc1cc(F)ccc1Nc1cncc(C(=O)O)n1 |
| InChI | InChI=1S/C12H10FN3O3/c1-19-10-4-7(13)2-3-8(10)15-11-6-14-5-9(16-11)12(17)18/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | IWCDLJQLLPYRJE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |