C14H22N6O4S — CID 140787071
O-[(2R)-2-acetamido-3-amino-3-oxopropyl] 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanethioate (PubChem CID 140787071) has the molecular formula C14H22N6O4S and a molecular weight of 370.44 g/mol. Its IUPAC name is O-[(2R)-2-acetamido-3-amino-3-oxopropyl] 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanethioate.
| Compound Name | O-[(2R)-2-acetamido-3-amino-3-oxopropyl] 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanethioate |
|---|---|
| PubChem CID | 140787071 |
| Molecular Formula | C14H22N6O4S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | O-[(2R)-2-acetamido-3-amino-3-oxopropyl] 2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanethioate |
| SMILES | CC(=O)N[C@H](COC(=S)C(Cc1cnc[nH]1)NC(=O)CCN)C(N)=O |
| InChI | InChI=1S/C14H22N6O4S/c1-8(21)19-11(13(16)23)6-24-14(25)10(20-12(22)2-3-15)4-9-5-17-7-18-9/h5,7,10-11H,2-4,6,15H2,1H3,(H2,16,23)(H,17,18)(H,19,21)(H,20,22)/t10?,11-/m1/s1 |
| InChIKey | IQQFTFRIJZHPHA-RRKGBCIJSA-N |
| XLogP | -1.88 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|