C12H20N6O5 — CID 66571938
3-[[(2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]propyl nitrate (PubChem CID 66571938) has the molecular formula C12H20N6O5 and a molecular weight of 328.33 g/mol. Its IUPAC name is 3-[[(2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]propyl nitrate.
| Compound Name | 3-[[(2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]propyl nitrate |
|---|---|
| PubChem CID | 66571938 |
| Molecular Formula | C12H20N6O5 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-[[(2S)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]propyl nitrate |
| SMILES | NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)NCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C12H20N6O5/c13-3-2-11(19)17-10(6-9-7-14-8-16-9)12(20)15-4-1-5-23-18(21)22/h7-8,10H,1-6,13H2,(H,14,16)(H,15,20)(H,17,19)/t10-/m0/s1 |
| InChIKey | SMHVQNAXIXUOKJ-JTQLQIEISA-N |
| XLogP | -1.50 |
| TPSA | 165.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|