C15H24ClN5O7 — CID 118913874
methyl 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoate;hydrochloride (PubChem CID 118913874) has the molecular formula C15H24ClN5O7 and a molecular weight of 421.84 g/mol. Its IUPAC name is methyl 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoate;hydrochloride.
| Compound Name | methyl 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 118913874 |
| Molecular Formula | C15H24ClN5O7 |
| Molecular Weight | 421.84 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | methyl 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoate;hydrochloride |
| SMILES | COC(=O)C(Cc1cnc[nH]1)NC(=O)CCNC(=O)CCCCO[N+](=O)[O-].Cl |
| InChI | InChI=1S/C15H23N5O7.ClH/c1-26-15(23)12(8-11-9-16-10-18-11)19-14(22)5-6-17-13(21)4-2-3-7-27-20(24)25;/h9-10,12H,2-8H2,1H3,(H,16,18)(H,17,21)(H,19,22);1H |
| InChIKey | WHXSWDAFOUMUMY-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 165.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.84 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|