C15H22N6O11 — CID 118913817
methyl 2-[3-[[2-(2,3-dinitrooxypropoxy)acetyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoate (PubChem CID 118913817) has the molecular formula C15H22N6O11 and a molecular weight of 462.37 g/mol. Its IUPAC name is methyl 2-[3-[[2-(2,3-dinitrooxypropoxy)acetyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoate.
| Compound Name | methyl 2-[3-[[2-(2,3-dinitrooxypropoxy)acetyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoate |
|---|---|
| PubChem CID | 118913817 |
| Molecular Formula | C15H22N6O11 |
| Molecular Weight | 462.37 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | methyl 2-[3-[[2-(2,3-dinitrooxypropoxy)acetyl]amino]propanoylamino]-3-(1H-imidazol-5-yl)propanoate |
| SMILES | COC(=O)C(Cc1cnc[nH]1)NC(=O)CCNC(=O)COCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N6O11/c1-29-15(24)12(4-10-5-16-9-18-10)19-13(22)2-3-17-14(23)8-30-6-11(32-21(27)28)7-31-20(25)26/h5,9,11-12H,2-4,6-8H2,1H3,(H,16,18)(H,17,23)(H,19,22) |
| InChIKey | VCRASHYMXZMWFG-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 227.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.37 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|