C17H22F3N5O8 — CID 118913842
(2,2,2-trifluoroacetyl) (2S)-3-(1H-imidazol-5-yl)-2-[3-(6-nitrooxyhexanoylamino)propanoylamino]propanoate (PubChem CID 118913842) has the molecular formula C17H22F3N5O8 and a molecular weight of 481.38 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-3-(1H-imidazol-5-yl)-2-[3-(6-nitrooxyhexanoylamino)propanoylamino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-3-(1H-imidazol-5-yl)-2-[3-(6-nitrooxyhexanoylamino)propanoylamino]propanoate |
|---|---|
| PubChem CID | 118913842 |
| Molecular Formula | C17H22F3N5O8 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-3-(1H-imidazol-5-yl)-2-[3-(6-nitrooxyhexanoylamino)propanoylamino]propanoate |
| SMILES | O=C(CCCCCO[N+](=O)[O-])NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H22F3N5O8/c18-17(19,20)16(29)33-15(28)12(8-11-9-21-10-23-11)24-14(27)5-6-22-13(26)4-2-1-3-7-32-25(30)31/h9-10,12H,1-8H2,(H,21,23)(H,22,26)(H,24,27)/t12-/m0/s1 |
| InChIKey | UMVTTYCXUWNZGQ-LBPRGKRZSA-N |
| XLogP | 0.34 |
| TPSA | 182.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|