C14H21N5O7 — CID 118913814
3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoic acid (PubChem CID 118913814) has the molecular formula C14H21N5O7 and a molecular weight of 371.35 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 118913814 |
| Molecular Formula | C14H21N5O7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[3-(5-nitrooxypentanoylamino)propanoylamino]propanoic acid |
| SMILES | O=C(CCCCO[N+](=O)[O-])NCCC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H21N5O7/c20-12(3-1-2-6-26-19(24)25)16-5-4-13(21)18-11(14(22)23)7-10-8-15-9-17-10/h8-9,11H,1-7H2,(H,15,17)(H,16,20)(H,18,21)(H,22,23) |
| InChIKey | CFXRTHZIPCRLKE-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 176.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|