C21H26N6O8 — CID 91468550
(4-acetamidophenyl) (2R)-3-(1H-imidazol-5-yl)-2-[3-(4-nitrooxybutanoylamino)propanoylamino]propanoate (PubChem CID 91468550) has the molecular formula C21H26N6O8 and a molecular weight of 490.47 g/mol. Its IUPAC name is (4-acetamidophenyl) (2R)-3-(1H-imidazol-5-yl)-2-[3-(4-nitrooxybutanoylamino)propanoylamino]propanoate.
| Compound Name | (4-acetamidophenyl) (2R)-3-(1H-imidazol-5-yl)-2-[3-(4-nitrooxybutanoylamino)propanoylamino]propanoate |
|---|---|
| PubChem CID | 91468550 |
| Molecular Formula | C21H26N6O8 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (4-acetamidophenyl) (2R)-3-(1H-imidazol-5-yl)-2-[3-(4-nitrooxybutanoylamino)propanoylamino]propanoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)[C@@H](Cc2cnc[nH]2)NC(=O)CCNC(=O)CCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N6O8/c1-14(28)25-15-4-6-17(7-5-15)35-21(31)18(11-16-12-22-13-24-16)26-20(30)8-9-23-19(29)3-2-10-34-27(32)33/h4-7,12-13,18H,2-3,8-11H2,1H3,(H,22,24)(H,23,29)(H,25,28)(H,26,30)/t18-/m1/s1 |
| InChIKey | JVNWYOGKWMDJIX-GOSISDBHSA-N |
| XLogP | 0.50 |
| TPSA | 194.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|