C47H60Si — CID 140789626
bis[4-(4-tert-butylphenyl)-2-methyl-2,3-dihydro-1H-inden-1-yl]-cyclohexyl-methylsilane (PubChem CID 140789626) has the molecular formula C47H60Si and a molecular weight of 653.08 g/mol. Its IUPAC name is bis[4-(4-tert-butylphenyl)-2-methyl-2,3-dihydro-1H-inden-1-yl]-cyclohexyl-methylsilane.
| Compound Name | bis[4-(4-tert-butylphenyl)-2-methyl-2,3-dihydro-1H-inden-1-yl]-cyclohexyl-methylsilane |
|---|---|
| PubChem CID | 140789626 |
| Molecular Formula | C47H60Si |
| Molecular Weight | 653.08 g/mol |
| Exact Mass | 652.45 |
| IUPAC Name | bis[4-(4-tert-butylphenyl)-2-methyl-2,3-dihydro-1H-inden-1-yl]-cyclohexyl-methylsilane |
| SMILES | CC1Cc2c(-c3ccc(C(C)(C)C)cc3)cccc2C1[Si](C)(C1CCCCC1)C1c2cccc(-c3ccc(C(C)(C)C)cc3)c2CC1C |
| InChI | InChI=1S/C47H60Si/c1-31-29-42-38(33-21-25-35(26-22-33)46(3,4)5)17-13-19-40(42)44(31)48(9,37-15-11-10-12-16-37)45-32(2)30-43-39(18-14-20-41(43)45)34-23-27-36(28-24-34)47(6,7)8/h13-14,17-28,31-32,37,44-45H,10-12,15-16,29-30H2,1-9H3 |
| InChIKey | OBNKTTVIONYLNI-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.08 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|