C76H80Br2N2 — CID 171434162
1-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]-1-N,3-N-bis(4-bromophenyl)-5-cyclohexylbenzene-1,3-diamine (PubChem CID 171434162) has the molecular formula C76H80Br2N2 and a molecular weight of 1181.30 g/mol. Its IUPAC name is 1-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]-1-N,3-N-bis(4-bromophenyl)-5-cyclohexylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]-1-N,3-N-bis(4-bromophenyl)-5-cyclohexylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 171434162 |
| Molecular Formula | C76H80Br2N2 |
| Molecular Weight | 1181.30 g/mol |
| Exact Mass | 1178.47 |
| IUPAC Name | 1-N,3-N-bis[2,6-bis(4-tert-butylphenyl)phenyl]-1-N,3-N-bis(4-bromophenyl)-5-cyclohexylbenzene-1,3-diamine |
| SMILES | CC(C)(C)c1ccc(-c2cccc(-c3ccc(C(C)(C)C)cc3)c2N(c2ccc(Br)cc2)c2cc(C3CCCCC3)cc(N(c3ccc(Br)cc3)c3c(-c4ccc(C(C)(C)C)cc4)cccc3-c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C76H80Br2N2/c1-73(2,3)57-32-24-52(25-33-57)67-20-16-21-68(53-26-34-58(35-27-53)74(4,5)6)71(67)79(63-44-40-61(77)41-45-63)65-48-56(51-18-14-13-15-19-51)49-66(50-65)80(64-46-42-62(78)43-47-64)72-69(54-28-36-59(37-29-54)75(7,8)9)22-17-23-70(72)55-30-38-60(39-31-55)76(10,11)12/h16-17,20-51H,13-15,18-19H2,1-12H3 |
| InChIKey | WBNPCFRCHFPLSX-UHFFFAOYSA-N |
| XLogP | 24.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1181.30 |
| LogP ≤ 5 | 24.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |