C48H50BrN — CID 171607316
N-(3-bromo-5-tert-butylphenyl)-N-[4-(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylaniline (PubChem CID 171607316) has the molecular formula C48H50BrN and a molecular weight of 720.84 g/mol. Its IUPAC name is N-(3-bromo-5-tert-butylphenyl)-N-[4-(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylaniline.
| Compound Name | N-(3-bromo-5-tert-butylphenyl)-N-[4-(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylaniline |
|---|---|
| PubChem CID | 171607316 |
| Molecular Formula | C48H50BrN |
| Molecular Weight | 720.84 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | N-(3-bromo-5-tert-butylphenyl)-N-[4-(3,5-ditert-butylphenyl)phenyl]-2,6-diphenylaniline |
| SMILES | CC(C)(C)c1cc(Br)cc(N(c2ccc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc2)c2c(-c3ccccc3)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C48H50BrN/c1-46(2,3)37-27-36(28-38(29-37)47(4,5)6)33-23-25-41(26-24-33)50(42-31-39(48(7,8)9)30-40(49)32-42)45-43(34-17-12-10-13-18-34)21-16-22-44(45)35-19-14-11-15-20-35/h10-32H,1-9H3 |
| InChIKey | AYDNDTMVSSBGEV-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.84 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |