C22H22BrN — CID 164760129
3-bromo-5-tert-butyl-N,N-diphenylaniline (PubChem CID 164760129) has the molecular formula C22H22BrN and a molecular weight of 380.33 g/mol. Its IUPAC name is 3-bromo-5-tert-butyl-N,N-diphenylaniline.
| Compound Name | 3-bromo-5-tert-butyl-N,N-diphenylaniline |
|---|---|
| PubChem CID | 164760129 |
| Molecular Formula | C22H22BrN |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 3-bromo-5-tert-butyl-N,N-diphenylaniline |
| SMILES | CC(C)(C)c1cc(Br)cc(N(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H22BrN/c1-22(2,3)17-14-18(23)16-21(15-17)24(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-16H,1-3H3 |
| InChIKey | ZGGFKMLUBOLMLE-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |