C34H29Br2N — CID 170413315
N-(3-bromo-5-tert-butylphenyl)-N-(4-bromophenyl)-2,4-diphenylaniline (PubChem CID 170413315) has the molecular formula C34H29Br2N and a molecular weight of 611.42 g/mol. Its IUPAC name is N-(3-bromo-5-tert-butylphenyl)-N-(4-bromophenyl)-2,4-diphenylaniline.
| Compound Name | N-(3-bromo-5-tert-butylphenyl)-N-(4-bromophenyl)-2,4-diphenylaniline |
|---|---|
| PubChem CID | 170413315 |
| Molecular Formula | C34H29Br2N |
| Molecular Weight | 611.42 g/mol |
| Exact Mass | 609.07 |
| IUPAC Name | N-(3-bromo-5-tert-butylphenyl)-N-(4-bromophenyl)-2,4-diphenylaniline |
| SMILES | CC(C)(C)c1cc(Br)cc(N(c2ccc(Br)cc2)c2ccc(-c3ccccc3)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C34H29Br2N/c1-34(2,3)27-21-29(36)23-31(22-27)37(30-17-15-28(35)16-18-30)33-19-14-26(24-10-6-4-7-11-24)20-32(33)25-12-8-5-9-13-25/h4-23H,1-3H3 |
| InChIKey | UHVPABOCTFWXPE-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.42 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |