C46H36BrNO — CID 177067483
N-(3-bromo-5-tert-butylphenyl)-2,4-diphenyl-N-(4-phenylphenyl)dibenzofuran-1-amine (PubChem CID 177067483) has the molecular formula C46H36BrNO and a molecular weight of 698.70 g/mol. Its IUPAC name is N-(3-bromo-5-tert-butylphenyl)-2,4-diphenyl-N-(4-phenylphenyl)dibenzofuran-1-amine.
| Compound Name | N-(3-bromo-5-tert-butylphenyl)-2,4-diphenyl-N-(4-phenylphenyl)dibenzofuran-1-amine |
|---|---|
| PubChem CID | 177067483 |
| Molecular Formula | C46H36BrNO |
| Molecular Weight | 698.70 g/mol |
| Exact Mass | 697.20 |
| IUPAC Name | N-(3-bromo-5-tert-butylphenyl)-2,4-diphenyl-N-(4-phenylphenyl)dibenzofuran-1-amine |
| SMILES | CC(C)(C)c1cc(Br)cc(N(c2ccc(-c3ccccc3)cc2)c2c(-c3ccccc3)cc(-c3ccccc3)c3oc4ccccc4c23)c1 |
| InChI | InChI=1S/C46H36BrNO/c1-46(2,3)35-27-36(47)29-38(28-35)48(37-25-23-32(24-26-37)31-15-7-4-8-16-31)44-40(33-17-9-5-10-18-33)30-41(34-19-11-6-12-20-34)45-43(44)39-21-13-14-22-42(39)49-45/h4-30H,1-3H3 |
| InChIKey | TYRCPNGFHXEXAT-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.70 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |