C37H37Br2N3 — CID 156680691
2-N,6-N-bis(3-bromo-5-tert-butylphenyl)-2-N,6-N-diphenylpyridine-2,6-diamine (PubChem CID 156680691) has the molecular formula C37H37Br2N3 and a molecular weight of 683.53 g/mol. Its IUPAC name is 2-N,6-N-bis(3-bromo-5-tert-butylphenyl)-2-N,6-N-diphenylpyridine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(3-bromo-5-tert-butylphenyl)-2-N,6-N-diphenylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 156680691 |
| Molecular Formula | C37H37Br2N3 |
| Molecular Weight | 683.53 g/mol |
| Exact Mass | 681.14 |
| IUPAC Name | 2-N,6-N-bis(3-bromo-5-tert-butylphenyl)-2-N,6-N-diphenylpyridine-2,6-diamine |
| SMILES | CC(C)(C)c1cc(Br)cc(N(c2ccccc2)c2cccc(N(c3ccccc3)c3cc(Br)cc(C(C)(C)C)c3)n2)c1 |
| InChI | InChI=1S/C37H37Br2N3/c1-36(2,3)26-20-28(38)24-32(22-26)41(30-14-9-7-10-15-30)34-18-13-19-35(40-34)42(31-16-11-8-12-17-31)33-23-27(37(4,5)6)21-29(39)25-33/h7-25H,1-6H3 |
| InChIKey | PTLBVKQLCPZHSX-UHFFFAOYSA-N |
| XLogP | 12.14 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.53 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |