C47H39NO — CID 169076927
[3-tert-butyl-5-(N-(2,6-diphenylphenyl)-4-phenylanilino)phenyl]-phenylmethanone (PubChem CID 169076927) has the molecular formula C47H39NO and a molecular weight of 633.84 g/mol. Its IUPAC name is [3-tert-butyl-5-(N-(2,6-diphenylphenyl)-4-phenylanilino)phenyl]-phenylmethanone.
| Compound Name | [3-tert-butyl-5-(N-(2,6-diphenylphenyl)-4-phenylanilino)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 169076927 |
| Molecular Formula | C47H39NO |
| Molecular Weight | 633.84 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | [3-tert-butyl-5-(N-(2,6-diphenylphenyl)-4-phenylanilino)phenyl]-phenylmethanone |
| SMILES | CC(C)(C)c1cc(C(=O)c2ccccc2)cc(N(c2ccc(-c3ccccc3)cc2)c2c(-c3ccccc3)cccc2-c2ccccc2)c1 |
| InChI | InChI=1S/C47H39NO/c1-47(2,3)40-31-39(46(49)38-23-14-7-15-24-38)32-42(33-40)48(41-29-27-35(28-30-41)34-17-8-4-9-18-34)45-43(36-19-10-5-11-20-36)25-16-26-44(45)37-21-12-6-13-22-37/h4-33H,1-3H3 |
| InChIKey | XUCUZHLPZIBKEQ-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.84 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |