C86H88N2 — CID 176815118
5-tert-butyl-1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-1-N,3-N-bis(3-tert-butyl-4-phenylphenyl)benzene-1,3-diamine (PubChem CID 176815118) has the molecular formula C86H88N2 and a molecular weight of 1149.66 g/mol. Its IUPAC name is 5-tert-butyl-1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-1-N,3-N-bis(3-tert-butyl-4-phenylphenyl)benzene-1,3-diamine.
| Compound Name | 5-tert-butyl-1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-1-N,3-N-bis(3-tert-butyl-4-phenylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 176815118 |
| Molecular Formula | C86H88N2 |
| Molecular Weight | 1149.66 g/mol |
| Exact Mass | 1148.69 |
| IUPAC Name | 5-tert-butyl-1-N,3-N-bis(4-tert-butyl-2,6-diphenylphenyl)-1-N,3-N-bis(3-tert-butyl-4-phenylphenyl)benzene-1,3-diamine |
| SMILES | CC(C)(C)c1cc(N(c2ccc(-c3ccccc3)c(C(C)(C)C)c2)c2c(-c3ccccc3)cc(C(C)(C)C)cc2-c2ccccc2)cc(N(c2ccc(-c3ccccc3)c(C(C)(C)C)c2)c2c(-c3ccccc3)cc(C(C)(C)C)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C86H88N2/c1-82(2,3)65-50-70(87(68-46-48-72(59-34-22-16-23-35-59)78(57-68)85(10,11)12)80-74(61-38-26-18-27-39-61)52-66(83(4,5)6)53-75(80)62-40-28-19-29-41-62)56-71(51-65)88(69-47-49-73(60-36-24-17-25-37-60)79(58-69)86(13,14)15)81-76(63-42-30-20-31-43-63)54-67(84(7,8)9)55-77(81)64-44-32-21-33-45-64/h16-58H,1-15H3 |
| InChIKey | MKGMFUYRDSBITF-UHFFFAOYSA-N |
| XLogP | 25.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 88 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1149.66 |
| LogP ≤ 5 | 25.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |