C49H43N — CID 176781165
N-(2-tert-butyl-4,6-diphenylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine (PubChem CID 176781165) has the molecular formula C49H43N and a molecular weight of 645.89 g/mol. Its IUPAC name is N-(2-tert-butyl-4,6-diphenylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine.
| Compound Name | N-(2-tert-butyl-4,6-diphenylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 176781165 |
| Molecular Formula | C49H43N |
| Molecular Weight | 645.89 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | N-(2-tert-butyl-4,6-diphenylphenyl)-9,9-dimethyl-N-(4-phenylphenyl)fluoren-2-amine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(-c2ccccc2)c1N(c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C49H43N/c1-48(2,3)46-32-38(35-19-11-7-12-20-35)31-43(37-21-13-8-14-22-37)47(46)50(39-27-25-36(26-28-39)34-17-9-6-10-18-34)40-29-30-42-41-23-15-16-24-44(41)49(4,5)45(42)33-40/h6-33H,1-5H3 |
| InChIKey | KFHYSSXQKKIMIU-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.89 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |