C37H36IrN2-2 — CID 140789930
iridium;3-methyl-2-phenylpyridine;4-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine (PubChem CID 140789930) has the molecular formula C37H36IrN2-2 and a molecular weight of 700.93 g/mol. Its IUPAC name is iridium;3-methyl-2-phenylpyridine;4-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine.
| Compound Name | iridium;3-methyl-2-phenylpyridine;4-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine |
|---|---|
| PubChem CID | 140789930 |
| Molecular Formula | C37H36IrN2-2 |
| Molecular Weight | 700.93 g/mol |
| Exact Mass | 701.25 |
| IUPAC Name | iridium;3-methyl-2-phenylpyridine;4-phenyl-2-(5,5,8,8-tetramethyl-6,7-dihydro-3H-naphthalen-3-id-2-yl)pyridine |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cc(-c4ccccc4)ccn3)[c-]cc21.Cc1cccnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C25H26N.C12H10N.Ir/c1-24(2)13-14-25(3,4)22-16-20(10-11-21(22)24)23-17-19(12-15-26-23)18-8-6-5-7-9-18;1-10-6-5-9-13-12(10)11-7-3-2-4-8-11;/h5-9,11-12,15-17H,13-14H2,1-4H3;2-7,9H,1H3;/q2*-1; |
| InChIKey | JFFFXCMZQJTAPG-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.93 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|