C18H24IrN2-2 — CID 140790078
iridium;1,4,4,7,7-pentamethyl-3-phenyl-5,6-dihydro-2H-benzimidazol-2-ide (PubChem CID 140790078) has the molecular formula C18H24IrN2-2 and a molecular weight of 460.62 g/mol. Its IUPAC name is iridium;1,4,4,7,7-pentamethyl-3-phenyl-5,6-dihydro-2H-benzimidazol-2-ide.
| Compound Name | iridium;1,4,4,7,7-pentamethyl-3-phenyl-5,6-dihydro-2H-benzimidazol-2-ide |
|---|---|
| PubChem CID | 140790078 |
| Molecular Formula | C18H24IrN2-2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | iridium;1,4,4,7,7-pentamethyl-3-phenyl-5,6-dihydro-2H-benzimidazol-2-ide |
| SMILES | CN1[CH-]N(c2[c-]cccc2)C2=C1C(C)(C)CCC2(C)C.[Ir] |
| InChI | InChI=1S/C18H24N2.Ir/c1-17(2)11-12-18(3,4)16-15(17)19(5)13-20(16)14-9-7-6-8-10-14;/h6-9,13H,11-12H2,1-5H3;/q-2; |
| InChIKey | PBORYYJSBCZDJW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|