C13H23NO4S — CID 140790101
tert-butyl (4R)-4-(acetylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 140790101) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is tert-butyl (4R)-4-(acetylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-(acetylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 140790101 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | tert-butyl (4R)-4-(acetylsulfanylmethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=O)SC[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23NO4S/c1-9(15)19-8-10-7-17-13(5,6)14(10)11(16)18-12(2,3)4/h10H,7-8H2,1-6H3/t10-/m1/s1 |
| InChIKey | AAULXBFCJJBWOW-SNVBAGLBSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|