C28H27N5O — CID 140791806
3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-8-(4-isocyanophenyl)-4-methoxyquinoline (PubChem CID 140791806) has the molecular formula C28H27N5O and a molecular weight of 449.56 g/mol. Its IUPAC name is 3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-8-(4-isocyanophenyl)-4-methoxyquinoline.
| Compound Name | 3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-8-(4-isocyanophenyl)-4-methoxyquinoline |
|---|---|
| PubChem CID | 140791806 |
| Molecular Formula | C28H27N5O |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 3-[4-(2,6-dimethyl-4-pyridinyl)piperazin-1-yl]-8-(4-isocyanophenyl)-4-methoxyquinoline |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(OC)c(N4CCN(c5cc(C)nc(C)c5)CC4)cnc23)cc1 |
| InChI | InChI=1S/C28H27N5O/c1-19-16-23(17-20(2)31-19)32-12-14-33(15-13-32)26-18-30-27-24(6-5-7-25(27)28(26)34-4)21-8-10-22(29-3)11-9-21/h5-11,16-18H,12-15H2,1-2,4H3 |
| InChIKey | UKRWCPBKXSNZBY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 45.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|