C31H29N5O3 — CID 140791943
methyl 6-[4-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-2-hydroxy-2-methylpiperazin-1-yl]pyridine-3-carboxylate (PubChem CID 140791943) has the molecular formula C31H29N5O3 and a molecular weight of 519.61 g/mol. Its IUPAC name is methyl 6-[4-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-2-hydroxy-2-methylpiperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[4-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-2-hydroxy-2-methylpiperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 140791943 |
| Molecular Formula | C31H29N5O3 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | methyl 6-[4-[4-cyclopropyl-8-(4-isocyanophenyl)quinolin-3-yl]-2-hydroxy-2-methylpiperazin-1-yl]pyridine-3-carboxylate |
| SMILES | [C-]#[N+]c1ccc(-c2cccc3c(C4CC4)c(N4CCN(c5ccc(C(=O)OC)cn5)C(C)(O)C4)cnc23)cc1 |
| InChI | InChI=1S/C31H29N5O3/c1-31(38)19-35(15-16-36(31)27-14-11-22(17-33-27)30(37)39-3)26-18-34-29-24(20-9-12-23(32-2)13-10-20)5-4-6-25(29)28(26)21-7-8-21/h4-6,9-14,17-18,21,38H,7-8,15-16,19H2,1,3H3 |
| InChIKey | GJRZMSABKLEQOT-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|