About cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)
cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) (PubChem CID 140793716) has the molecular formula C24H24CoN4
and a molecular weight of 427.42 g/mol. Its IUPAC name is cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine).
Molecular Properties
| Compound Name | cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) |
| PubChem CID | 140793716 |
| Molecular Formula | C24H24CoN4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) |
| SMILES | Cc1cccc(-c2cccc(C)n2)n1.Cc1cccc(-c2cccc(C)n2)n1.[Co] |
| InChI | InChI=1S/2C12H12N2.Co/c2*1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12;/h2*3-8H,1-2H3; |
| InChIKey | UCFSGNLSRJRXBL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
The IUPAC name of cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) (CID 140793716) is cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine).
What is the SMILES notation for cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
The canonical SMILES for cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) is Cc1cccc(-c2cccc(C)n2)n1.Cc1cccc(-c2cccc(C)n2)n1.[Co].
What is the InChIKey of cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
The InChIKey is UCFSGNLSRJRXBL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H12N2.Co/c2*1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12;/h2*3-8H,1-2H3;.
What are the key properties of cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) has a molecular weight of 427.42 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) is sourced from PubChem (CID 140793716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).