C50H29N5 — CID 140793800
5-isocyano-2-[2,3,4-tri(carbazol-9-yl)phenyl]benzonitrile (PubChem CID 140793800) has the molecular formula C50H29N5 and a molecular weight of 699.82 g/mol. Its IUPAC name is 5-isocyano-2-[2,3,4-tri(carbazol-9-yl)phenyl]benzonitrile.
| Compound Name | 5-isocyano-2-[2,3,4-tri(carbazol-9-yl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 140793800 |
| Molecular Formula | C50H29N5 |
| Molecular Weight | 699.82 g/mol |
| Exact Mass | 699.24 |
| IUPAC Name | 5-isocyano-2-[2,3,4-tri(carbazol-9-yl)phenyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-n3c4ccccc4c4ccccc43)c(-n3c4ccccc4c4ccccc43)c2-n2c3ccccc3c3ccccc32)c(C#N)c1 |
| InChI | InChI=1S/C50H29N5/c1-52-33-26-27-34(32(30-33)31-51)41-28-29-48(53-42-20-8-2-14-35(42)36-15-3-9-21-43(36)53)50(55-46-24-12-6-18-39(46)40-19-7-13-25-47(40)55)49(41)54-44-22-10-4-16-37(44)38-17-5-11-23-45(38)54/h2-30H |
| InChIKey | WPXJPINUUQJBBA-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 42.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.82 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|