C54H29N7 — CID 161236433
4-[9-[2-[2-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-methylphenyl]-4-isocyanophenyl]carbazol-3-yl]benzene-1,3-dicarbonitrile (PubChem CID 161236433) has the molecular formula C54H29N7 and a molecular weight of 775.87 g/mol. Its IUPAC name is 4-[9-[2-[2-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-methylphenyl]-4-isocyanophenyl]carbazol-3-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[9-[2-[2-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-methylphenyl]-4-isocyanophenyl]carbazol-3-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 161236433 |
| Molecular Formula | C54H29N7 |
| Molecular Weight | 775.87 g/mol |
| Exact Mass | 775.25 |
| IUPAC Name | 4-[9-[2-[2-[3-(2,4-diisocyanophenyl)carbazol-9-yl]-3-methylphenyl]-4-isocyanophenyl]carbazol-3-yl]benzene-1,3-dicarbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2ccc3c(c2)c2ccccc2n3-c2c(C)cccc2-c2cc([N+]#[C-])ccc2-n2c3ccccc3c3cc(-c4ccc(C#N)cc4C#N)ccc32)c([N+]#[C-])c1 |
| InChI | InChI=1S/C54H29N7/c1-33-10-9-13-44(54(33)61-50-15-8-6-12-43(50)46-28-36(18-24-53(46)61)41-22-19-39(58-3)30-48(41)59-4)47-29-38(57-2)20-25-52(47)60-49-14-7-5-11-42(49)45-27-35(17-23-51(45)60)40-21-16-34(31-55)26-37(40)32-56/h5-30H,1H3 |
| InChIKey | QAHAABFGJCQBLC-UHFFFAOYSA-N |
| XLogP | 14.59 |
| TPSA | 70.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.87 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|