C18H12F6N8Pt — CID 140795516
bis(2-methyl-5-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyrazine);platinum(2+) (PubChem CID 140795516) has the molecular formula C18H12F6N8Pt and a molecular weight of 649.42 g/mol. Its IUPAC name is bis(2-methyl-5-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyrazine);platinum(2+).
| Compound Name | bis(2-methyl-5-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyrazine);platinum(2+) |
|---|---|
| PubChem CID | 140795516 |
| Molecular Formula | C18H12F6N8Pt |
| Molecular Weight | 649.42 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | bis(2-methyl-5-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyrazine);platinum(2+) |
| SMILES | Cc1cnc(-c2cc(C(F)(F)F)n[n-]2)cn1.Cc1cnc(-c2cc(C(F)(F)F)n[n-]2)cn1.[Pt+2] |
| InChI | InChI=1S/2C9H6F3N4.Pt/c2*1-5-3-14-7(4-13-5)6-2-8(16-15-6)9(10,11)12;/h2*2-4H,1H3;/q2*-1;+2 |
| InChIKey | VTSZKOUUJDYQDT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 105.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |