C36H54Sn3 — CID 140796455
[3-butyl-6,7-bis(hexyl-λ2-stannanyl)anthracen-2-yl]-hexyltin (PubChem CID 140796455) has the molecular formula C36H54Sn3 and a molecular weight of 842.96 g/mol. Its IUPAC name is [3-butyl-6,7-bis(hexyl-λ2-stannanyl)anthracen-2-yl]-hexyltin.
| Compound Name | [3-butyl-6,7-bis(hexyl-λ2-stannanyl)anthracen-2-yl]-hexyltin |
|---|---|
| PubChem CID | 140796455 |
| Molecular Formula | C36H54Sn3 |
| Molecular Weight | 842.96 g/mol |
| Exact Mass | 846.13 |
| IUPAC Name | [3-butyl-6,7-bis(hexyl-λ2-stannanyl)anthracen-2-yl]-hexyltin |
| SMILES | CCCCCC[Sn]c1cc2cc3cc([Sn]CCCCCC)c([Sn]CCCCCC)cc3cc2cc1CCCC |
| InChI | InChI=1S/C18H15.3C6H13.3Sn/c1-2-3-6-14-9-10-17-12-15-7-4-5-8-16(15)13-18(17)11-14;3*1-3-5-6-4-2;;;/h7-8,10-13H,2-3,6H2,1H3;3*1,3-6H2,2H3;;; |
| InChIKey | ZUPUUDMHHRRXOQ-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.96 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|