C36H41BrNO2P — CID 140797281
tert-butyl 4-[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-3-methylphenyl]piperidine-1-carboxylate (PubChem CID 140797281) has the molecular formula C36H41BrNO2P and a molecular weight of 630.61 g/mol. Its IUPAC name is tert-butyl 4-[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-3-methylphenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-3-methylphenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140797281 |
| Molecular Formula | C36H41BrNO2P |
| Molecular Weight | 630.61 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | tert-butyl 4-[4-[[bromo(triphenyl)-λ5-phosphanyl]methyl]-3-methylphenyl]piperidine-1-carboxylate |
| SMILES | Cc1cc(C2CCN(C(=O)OC(C)(C)C)CC2)ccc1CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H41BrNO2P/c1-28-26-30(29-22-24-38(25-23-29)35(39)40-36(2,3)4)20-21-31(28)27-41(37,32-14-8-5-9-15-32,33-16-10-6-11-17-33)34-18-12-7-13-19-34/h5-21,26,29H,22-25,27H2,1-4H3 |
| InChIKey | CMANZTWNGJMZJX-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.61 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|