C22H39N3O3S — CID 140797360
N-(1-cyclohexyl-5-oxopyrrolidin-3-yl)-5-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonamide (PubChem CID 140797360) has the molecular formula C22H39N3O3S and a molecular weight of 425.64 g/mol. Its IUPAC name is N-(1-cyclohexyl-5-oxopyrrolidin-3-yl)-5-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonamide.
| Compound Name | N-(1-cyclohexyl-5-oxopyrrolidin-3-yl)-5-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 140797360 |
| Molecular Formula | C22H39N3O3S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-(1-cyclohexyl-5-oxopyrrolidin-3-yl)-5-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonamide |
| SMILES | CN(C)C1CCCC2C1CCCC2S(=O)(=O)NC1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C22H39N3O3S/c1-24(2)20-12-6-11-19-18(20)10-7-13-21(19)29(27,28)23-16-14-22(26)25(15-16)17-8-4-3-5-9-17/h16-21,23H,3-15H2,1-2H3 |
| InChIKey | GOORVKRMXZJIQL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |