C24H29N6O4- — CID 140797934
4-[[3-[1-(5-aminopentyl)pyrazol-4-yl]benzoyl]amino]-1-(oxan-4-yl)pyrazole-3-carboxylate (PubChem CID 140797934) has the molecular formula C24H29N6O4- and a molecular weight of 465.53 g/mol. Its IUPAC name is 4-[[3-[1-(5-aminopentyl)pyrazol-4-yl]benzoyl]amino]-1-(oxan-4-yl)pyrazole-3-carboxylate.
| Compound Name | 4-[[3-[1-(5-aminopentyl)pyrazol-4-yl]benzoyl]amino]-1-(oxan-4-yl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 140797934 |
| Molecular Formula | C24H29N6O4- |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 4-[[3-[1-(5-aminopentyl)pyrazol-4-yl]benzoyl]amino]-1-(oxan-4-yl)pyrazole-3-carboxylate |
| SMILES | NCCCCCn1cc(-c2cccc(C(=O)Nc3cn(C4CCOCC4)nc3C(=O)[O-])c2)cn1 |
| InChI | InChI=1S/C24H30N6O4/c25-9-2-1-3-10-29-15-19(14-26-29)17-5-4-6-18(13-17)23(31)27-21-16-30(28-22(21)24(32)33)20-7-11-34-12-8-20/h4-6,13-16,20H,1-3,7-12,25H2,(H,27,31)(H,32,33)/p-1 |
| InChIKey | NYRBLZKHLBFURH-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 140.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|