C17H15ClN5O3- — CID 140811378
4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methylpyrazole-3-carboxylate (PubChem CID 140811378) has the molecular formula C17H15ClN5O3- and a molecular weight of 372.79 g/mol. Its IUPAC name is 4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methylpyrazole-3-carboxylate.
| Compound Name | 4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 140811378 |
| Molecular Formula | C17H15ClN5O3- |
| Molecular Weight | 372.79 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 4-[[3-[1-(2-chloroethyl)pyrazol-4-yl]benzoyl]amino]-1-methylpyrazole-3-carboxylate |
| SMILES | Cn1cc(NC(=O)c2cccc(-c3cnn(CCCl)c3)c2)c(C(=O)[O-])n1 |
| InChI | InChI=1S/C17H16ClN5O3/c1-22-10-14(15(21-22)17(25)26)20-16(24)12-4-2-3-11(7-12)13-8-19-23(9-13)6-5-18/h2-4,7-10H,5-6H2,1H3,(H,20,24)(H,25,26)/p-1 |
| InChIKey | RWKNUPDOZXWJML-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|