C21H25ClN8O3 — CID 122472125
6-[1-(2-chloroethyl)pyrazol-4-yl]-N-[1-methyl-3-(morpholin-2-ylmethylcarbamoyl)pyrazol-4-yl]pyridine-2-carboxamide (PubChem CID 122472125) has the molecular formula C21H25ClN8O3 and a molecular weight of 472.94 g/mol. Its IUPAC name is 6-[1-(2-chloroethyl)pyrazol-4-yl]-N-[1-methyl-3-(morpholin-2-ylmethylcarbamoyl)pyrazol-4-yl]pyridine-2-carboxamide.
| Compound Name | 6-[1-(2-chloroethyl)pyrazol-4-yl]-N-[1-methyl-3-(morpholin-2-ylmethylcarbamoyl)pyrazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 122472125 |
| Molecular Formula | C21H25ClN8O3 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 6-[1-(2-chloroethyl)pyrazol-4-yl]-N-[1-methyl-3-(morpholin-2-ylmethylcarbamoyl)pyrazol-4-yl]pyridine-2-carboxamide |
| SMILES | Cn1cc(NC(=O)c2cccc(-c3cnn(CCCl)c3)n2)c(C(=O)NCC2CNCCO2)n1 |
| InChI | InChI=1S/C21H25ClN8O3/c1-29-13-18(19(28-29)21(32)24-11-15-10-23-6-8-33-15)27-20(31)17-4-2-3-16(26-17)14-9-25-30(12-14)7-5-22/h2-4,9,12-13,15,23H,5-8,10-11H2,1H3,(H,24,32)(H,27,31) |
| InChIKey | GQNODYUPAHJVKR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 127.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|