C20H21LiN6O5 — CID 122445435
lithium 4-[[3-[[3-(3-aminopropoxy)-6-oxopyridazin-1-yl]methyl]benzoyl]amino]-1-methylpyrazole-3-carboxylate (PubChem CID 122445435) has the molecular formula C20H21LiN6O5 and a molecular weight of 432.37 g/mol. Its IUPAC name is lithium 4-[[3-[[3-(3-aminopropoxy)-6-oxopyridazin-1-yl]methyl]benzoyl]amino]-1-methylpyrazole-3-carboxylate.
| Compound Name | lithium 4-[[3-[[3-(3-aminopropoxy)-6-oxopyridazin-1-yl]methyl]benzoyl]amino]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 122445435 |
| Molecular Formula | C20H21LiN6O5 |
| Molecular Weight | 432.37 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | lithium 4-[[3-[[3-(3-aminopropoxy)-6-oxopyridazin-1-yl]methyl]benzoyl]amino]-1-methylpyrazole-3-carboxylate |
| SMILES | Cn1cc(NC(=O)c2cccc(Cn3nc(OCCCN)ccc3=O)c2)c(C(=O)[O-])n1.[Li+] |
| InChI | InChI=1S/C20H22N6O5.Li/c1-25-12-15(18(24-25)20(29)30)22-19(28)14-5-2-4-13(10-14)11-26-17(27)7-6-16(23-26)31-9-3-8-21;/h2,4-7,10,12H,3,8-9,11,21H2,1H3,(H,22,28)(H,29,30);/q;+1/p-1 |
| InChIKey | UAQVLMLZWIPOLL-UHFFFAOYSA-M |
| XLogP | -3.63 |
| TPSA | 157.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.37 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|