C25H28F3NO7S — CID 140798172
methyl (2S)-2-[2-benzyl-4,7-dimethyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-isoindol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 140798172) has the molecular formula C25H28F3NO7S and a molecular weight of 543.56 g/mol. Its IUPAC name is methyl (2S)-2-[2-benzyl-4,7-dimethyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-isoindol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl (2S)-2-[2-benzyl-4,7-dimethyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-isoindol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 140798172 |
| Molecular Formula | C25H28F3NO7S |
| Molecular Weight | 543.56 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | methyl (2S)-2-[2-benzyl-4,7-dimethyl-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-isoindol-5-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)[C@@H](OC(C)(C)C)c1c(C)c2c(c(C)c1OS(=O)(=O)C(F)(F)F)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C25H28F3NO7S/c1-14-17-13-29(12-16-10-8-7-9-11-16)22(30)18(17)15(2)19(20(14)36-37(32,33)25(26,27)28)21(23(31)34-6)35-24(3,4)5/h7-11,21H,12-13H2,1-6H3/t21-/m0/s1 |
| InChIKey | WCXNDOAVHJUHLD-NRFANRHFSA-N |
| XLogP | 4.72 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|