C28H47BF4N2O2Sn — CID 140799089
ethyl 3-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]benzoate tetrafluoroborate (PubChem CID 140799089) has the molecular formula C28H47BF4N2O2Sn and a molecular weight of 649.21 g/mol. Its IUPAC name is ethyl 3-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]benzoate tetrafluoroborate.
| Compound Name | ethyl 3-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]benzoate tetrafluoroborate |
|---|---|
| PubChem CID | 140799089 |
| Molecular Formula | C28H47BF4N2O2Sn |
| Molecular Weight | 649.21 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | ethyl 3-[dibutyl-[6-(3-ethylimidazol-1-ium-1-yl)hexyl]stannyl]benzoate tetrafluoroborate |
| SMILES | CCCC[Sn](CCCC)(CCCCCC[n+]1ccn(CC)c1)c1cccc(C(=O)OCC)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C11H20N2.C9H9O2.2C4H9.BF4.Sn/c1-3-5-6-7-8-13-10-9-12(4-2)11-13;1-2-11-9(10)8-6-4-3-5-7-8;2*1-3-4-2;2-1(3,4)5;/h9-11H,1,3-8H2,2H3;3-4,6-7H,2H2,1H3;2*1,3-4H2,2H3;;/q+1;;;;-1; |
| InChIKey | TXANZDRZXNBEQO-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.21 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|