(2-carbazol-9-yldibenzothiophen-4-yl)boronic acid

C24H16BNO2S — CID 140799194

IUPAC(2-carbazol-9-yldibenzothiophen-4-yl)boronic acid
SMILESOB(O)c1cc(-n2c3ccccc3c3ccccc32)cc2c1sc1ccccc12
InChIInChI=1S/C24H16BNO2S/c27-25(28)20-14-15(13-19-18-9-3-6-12-23(18)29-24(19)20)26-21-10-4-1-7-16(21)17-8-2-5-11-22(17)26/h1-14,27-28H
InChIKeyUXJDVQSTWWNNLS-UHFFFAOYSA-N
MW393.28 g/mol
LogP4.83
Rot. Bonds2

About (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid

(2-carbazol-9-yldibenzothiophen-4-yl)boronic acid (PubChem CID 140799194) has the molecular formula C24H16BNO2S and a molecular weight of 393.28 g/mol. Its IUPAC name is (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid.

Molecular Properties

Compound Name(2-carbazol-9-yldibenzothiophen-4-yl)boronic acid
PubChem CID140799194
Molecular FormulaC24H16BNO2S
Molecular Weight393.28 g/mol
Exact Mass393.10
IUPAC Name(2-carbazol-9-yldibenzothiophen-4-yl)boronic acid
SMILESOB(O)c1cc(-n2c3ccccc3c3ccccc32)cc2c1sc1ccccc12
InChIInChI=1S/C24H16BNO2S/c27-25(28)20-14-15(13-19-18-9-3-6-12-23(18)29-24(19)20)26-21-10-4-1-7-16(21)17-8-2-5-11-22(17)26/h1-14,27-28H
InChIKeyUXJDVQSTWWNNLS-UHFFFAOYSA-N
XLogP4.83
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500393.28
LogP ≤ 54.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid?
The IUPAC name of (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid (CID 140799194) is (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid.
What is the SMILES notation for (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid?
The canonical SMILES for (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid is OB(O)c1cc(-n2c3ccccc3c3ccccc32)cc2c1sc1ccccc12.
What is the InChIKey of (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid?
The InChIKey is UXJDVQSTWWNNLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16BNO2S/c27-25(28)20-14-15(13-19-18-9-3-6-12-23(18)29-24(19)20)26-21-10-4-1-7-16(21)17-8-2-5-11-22(17)26/h1-14,27-28H.
What are the key properties of (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid?
(2-carbazol-9-yldibenzothiophen-4-yl)boronic acid has a molecular weight of 393.28 g/mol, XLogP of 4.83, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbazol-9-yldibenzothiophen-4-yl)boronic acid is sourced from PubChem (CID 140799194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).