C23H43NOSn — CID 140799458
1-[(E)-3-hydroxy-4-methyl-1-tributylstannylpent-1-en-3-yl]cyclobutane-1-carbonitrile (PubChem CID 140799458) has the molecular formula C23H43NOSn and a molecular weight of 468.31 g/mol. Its IUPAC name is 1-[(E)-3-hydroxy-4-methyl-1-tributylstannylpent-1-en-3-yl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[(E)-3-hydroxy-4-methyl-1-tributylstannylpent-1-en-3-yl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 140799458 |
| Molecular Formula | C23H43NOSn |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 1-[(E)-3-hydroxy-4-methyl-1-tributylstannylpent-1-en-3-yl]cyclobutane-1-carbonitrile |
| SMILES | CCCC[Sn](/C=C/C(O)(C(C)C)C1(C#N)CCC1)(CCCC)CCCC |
| InChI | InChI=1S/C11H16NO.3C4H9.Sn/c1-4-11(13,9(2)3)10(8-12)6-5-7-10;3*1-3-4-2;/h1,4,9,13H,5-7H2,2-3H3;3*1,3-4H2,2H3; |
| InChIKey | XGJXQPRESAYQEX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |