C10H15NO — CID 24873688
2-[(1S,2R)-2-ethenyl-2-hydroxy-3,3-dimethylcyclobutyl]acetonitrile (PubChem CID 24873688) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-[(1S,2R)-2-ethenyl-2-hydroxy-3,3-dimethylcyclobutyl]acetonitrile.
| Compound Name | 2-[(1S,2R)-2-ethenyl-2-hydroxy-3,3-dimethylcyclobutyl]acetonitrile |
|---|---|
| PubChem CID | 24873688 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-[(1S,2R)-2-ethenyl-2-hydroxy-3,3-dimethylcyclobutyl]acetonitrile |
| SMILES | C=C[C@@]1(O)[C@H](CC#N)CC1(C)C |
| InChI | InChI=1S/C10H15NO/c1-4-10(12)8(5-6-11)7-9(10,2)3/h4,8,12H,1,5,7H2,2-3H3/t8-,10-/m1/s1 |
| InChIKey | HCSJULWSWURSKM-PSASIEDQSA-N |
| XLogP | 1.86 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|