C11H18BNO3 — CID 125469649
[(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid (PubChem CID 125469649) has the molecular formula C11H18BNO3 and a molecular weight of 223.08 g/mol. Its IUPAC name is [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid.
| Compound Name | [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid |
|---|---|
| PubChem CID | 125469649 |
| Molecular Formula | C11H18BNO3 |
| Molecular Weight | 223.08 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [(E,3S)-3-(1-cyanocyclobutyl)-3-hydroxy-4-methylpent-1-enyl]boronic acid |
| SMILES | CC(C)[C@](O)(/C=C/B(O)O)C1(C#N)CCC1 |
| InChI | InChI=1S/C11H18BNO3/c1-9(2)11(14,6-7-12(15)16)10(8-13)4-3-5-10/h6-7,9,14-16H,3-5H2,1-2H3/b7-6+/t11-/m1/s1 |
| InChIKey | CFYNUIAHIYNLRG-XUIVZRPNSA-N |
| XLogP | 0.64 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.08 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|