C14H25N2O2+ — CID 140802684
(1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-(3-methoxycyclobutyl)methanone (PubChem CID 140802684) has the molecular formula C14H25N2O2+ and a molecular weight of 253.37 g/mol. Its IUPAC name is (1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-(3-methoxycyclobutyl)methanone.
| Compound Name | (1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-(3-methoxycyclobutyl)methanone |
|---|---|
| PubChem CID | 140802684 |
| Molecular Formula | C14H25N2O2+ |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | (1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-yl)-(3-methoxycyclobutyl)methanone |
| SMILES | COC1CC(C(=O)N2CC=[N+](C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C14H25N2O2/c1-14(2,3)16-7-5-15(6-8-16)13(17)11-9-12(10-11)18-4/h7,11-12H,5-6,8-10H2,1-4H3/q+1 |
| InChIKey | HTFIJOOFPKZMOW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|