C13H25N2O2+ — CID 140893061
tert-butyl 1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate (PubChem CID 140893061) has the molecular formula C13H25N2O2+ and a molecular weight of 241.35 g/mol. Its IUPAC name is tert-butyl 1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate.
| Compound Name | tert-butyl 1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 140893061 |
| Molecular Formula | C13H25N2O2+ |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | tert-butyl 1-tert-butyl-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=[N+](C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25N2O2/c1-12(2,3)15-9-7-14(8-10-15)11(16)17-13(4,5)6/h9H,7-8,10H2,1-6H3/q+1 |
| InChIKey | DTBFYPJKAVKUCX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|